O-TOLIDINE SULFONE manufacturers
|
| Product Name: | O-TOLIDINE SULFONE | | Synonyms: | 3,7 DIAMINO-2,8-DIMETHYL DIBENZOTHIOPHENE 5,5-DIOXIDE;3,7-DIAMINO-2,8-DIMETHYLDIBENZOTHIOPHENE SULFONE;3,7-DIAMINO-2,8-DIMETHYLDIPHENYLENESULFONE;3,7-DIAMINO-2(4),8-DIMETHYLDIBENZOTHIOPHENE 5,5-DIOXIDE;O-TOLIDINE SULFONE;O-TOLUIDINE SULFONE;O-tolidine sulfone, mixture of isomers;O-TOLIDINE SULFONE 99% MIXTURE OF & | | CAS: | 55011-44-4 | | MF: | C14H14N2O2S | | MW: | 274.34 | | EINECS: | | | Product Categories: | | | Mol File: | 55011-44-4.mol |  |
| | O-TOLIDINE SULFONE Chemical Properties |
| Melting point | >350 °C(lit.) | | storage temp. | -20°C | | form | powder to crystal | | color | White to Yellow to Green | | biological source | rabbit | | InChI | InChI=1S/C14H14N2O2S/c1-7-3-9-10-4-8(2)12(16)6-14(10)19(17,18)13(9)5-11(7)15/h3-6H,15-16H2,1-2H3 | | InChIKey | OJSPYCPPVCMEBS-UHFFFAOYSA-N | | SMILES | C12=CC(N)=C(C)C=C1C1=CC(C)=C(N)C=C1S2(=O)=O |
| Hazard Codes | T,N | | Risk Statements | 45-22-51/53 | | Safety Statements | 53-45-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | WGK 1 | | HS Code | 2934.99.9001 | | Storage Class | 10 - Combustible liquids |
| | O-TOLIDINE SULFONE Usage And Synthesis |
| Application | O-TOLIDINE SULFONE can be used as a pharmaceutical synthesis intermediate. |
| | O-TOLIDINE SULFONE Preparation Products And Raw materials |
|