- Dibenzyl dicarbonate
-
- $1.00
-
2024-07-17
- CAS:31139-36-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
- Dibenzyl dicarbonate
-
- $1.80
-
2020-03-22
- CAS:31139-36-3
- Min. Order: 1g
- Purity: 90.0%-99.9%
- Supply Ability: 800kg
|
| | Dibenzyl dicarbonate Basic information |
| | Dibenzyl dicarbonate Chemical Properties |
| Melting point | 29-32 °C (lit.) | | Boiling point | 388.65°C (rough estimate) | | density | 1.17 g/mL at 25 °C (lit.) | | refractive index | 1.5000 (estimate) | | Fp | >230 °F | | storage temp. | -20°C | | form | powder to crystal | | color | White to Almost white | | BRN | 4324796 | | Major Application | peptide synthesis | | InChI | InChI=1S/C16H14O5/c17-15(19-11-13-7-3-1-4-8-13)21-16(18)20-12-14-9-5-2-6-10-14/h1-10H,11-12H2 | | InChIKey | FHRRJZZGSJXPRQ-UHFFFAOYSA-N | | SMILES | C1(=CC=CC=C1)COC(=O)OC(=O)OCC1C=CC=CC=1 | | CAS DataBase Reference | 31139-36-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 4.4-10-21 | | HS Code | 29209090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Dibenzyl dicarbonate Usage And Synthesis |
| Uses | Dibenzyl Dicarbonate is a chemical reagent used in the chemical modification of histidine residues in horseradish peroxidase. | | Synthesis Reference(s) | Tetrahedron Letters, 27, p. 5375, 1986 DOI: 10.1016/S0040-4039(00)85214-4 |
| | Dibenzyl dicarbonate Preparation Products And Raw materials |
|