PIGMENT GREEN 7 manufacturers
- PIGMENT GREEN 7
-
-
2025-06-27
- CAS:14832-14-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | PIGMENT GREEN 7 Basic information |
| Product Name: | PIGMENT GREEN 7 | | Synonyms: | copper,[1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecachloro-29h,31h-phtha;[1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecachloro-29H,31H-phthalocyaninato(2-)-N29,N30,N3Copper;PIGMENT GREEN 7;[1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecachloro-29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32]copper;7 PIGMENT GREEN 7;Copper, 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecachloro-29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32-, (SP-4-1)-;copper perchlorophthalocyanine;[1,2,3,4,8,9,10,11,15,16,17, 18, 22,23,24,25-hexadecachloro-29H,31H-phthalocyaninato-N29,N30,N3Copper | | CAS: | 14832-14-5 | | MF: | C32Cl16CuN8 | | MW: | 1127.15 | | EINECS: | 238-897-8 | | Product Categories: | Organometallics | | Mol File: | 14832-14-5.mol |  |
| | PIGMENT GREEN 7 Chemical Properties |
| form | solid | | InChIKey | ABFKYPFPQRDCGM-UHFFFAOYSA-N | | SMILES | Clc1c(Cl)c(Cl)c2c3nc(nc4n5[Cu]n6c(n3)c7c(Cl)c(Cl)c(Cl)c(Cl)c7c6nc8nc(nc5c9c(Cl)c(Cl)c(Cl)c(Cl)c49)c%10c(Cl)c(Cl)c(Cl)c(Cl)c8%10)c2c1Cl | | EPA Substance Registry System | Copper, [1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecachloro-29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- (14832-14-5) |
| WGK Germany | WGK 1 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | PIGMENT GREEN 7 Usage And Synthesis |
| reaction suitability | core: copper reagent type: catalyst |
| | PIGMENT GREEN 7 Preparation Products And Raw materials |
|