AC-IEPD-AMC manufacturers
- AC-IEPD-AMC
-
-
2026-07-24
- CAS:216757-33-4
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000kg
|
| | AC-IEPD-AMC Basic information |
| Product Name: | AC-IEPD-AMC | | Synonyms: | N-Acetyl-L-isoleucyl-L-alpha-glutamyl-L-prolyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-L-alpha-asparagine;GRANZYME B SUBSTRATE IX, FLUOROGENIC;AC-IEPD-AMC;AC-ILE-GLU-PRO-ASP-7-AMINO-4-METHYLCOUMARIN;N-ACETYL-ILE-GLU-PRO-ASP-7-AMIDO-4-METHYLCOUMARIN;AC-ILE-GLU-PRO-ASP-AMC;L-α-Asparagine, N-acetyl-L-isoleucyl-L-α-glutamyl-L-prolyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-;N-Acetyl-L-isoleucyl-L-α-glutamyl-L-prolyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-L-α-asparagine | | CAS: | 216757-33-4 | | MF: | C32H41N5O11 | | MW: | 671.7 | | EINECS: | | | Product Categories: | Pepetides;ADC Linker | | Mol File: | 216757-33-4.mol |  |
| | AC-IEPD-AMC Chemical Properties |
| Boiling point | 1116.0±65.0 °C(Predicted) | | density | 1.366±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMSO/DMF: 1 mg/mL | | pka | 4.12±0.10(Predicted) | | form | powder | | Sequence | Ac-Ile-Glu-Pro-Asp-{AMC} | | InChIKey | XDMHHBKPMUGLEA-MNTOYCOOSA-N | | SMILES | CC[C@H](C)[C@H](NC(C)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(O)=O)C(=O)Nc2ccc3C(C)=CC(=O)Oc3c2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | AC-IEPD-AMC Usage And Synthesis |
| Uses | Ac-IEPD-AMC is a fluorogenic substrate for the determination of protease activity. Ac-IEPD-AMC undergoes hydrolysis and releases the fluorescent product 7-amino-4-methylcoumarin (AMC). AMC is fluorescent under UV light and can emit a fluorescent signal[1]. | | References | [1] Scott JI, et, al. A Functional Chemiluminescent Probe for in Vivo Imaging of Natural Killer Cell Activity Against Tumours. Angew Chem Int Ed Engl. 2021 Mar 8;60(11):5699-5703. DOI:10.1002/anie.202011429 |
| | AC-IEPD-AMC Preparation Products And Raw materials |
|