|
|
| | GLYCOLALDEHYDE DIMER Basic information |
| Product Name: | GLYCOLALDEHYDE DIMER | | Synonyms: | Glycolaldehyde dimer, >=98%;Glycolaldehyde diMer crystalline, Mixture of stereoisoMers. Melts between 80 and 90C depending on stereoisoMeric coMposition;p-Dioxane-2,5-diol;GLYCOLALDEHYDE DIMER;2,5-DIHYDROXY-P-DIOXANE;glycolaldehyde dimer, mixture of stereoisomers;GLYCOLALDEHYDE DIMER, CRYSTALLINE;GLYCOLALDEHYDE DIMER extrapure | | CAS: | 23147-58-2 | | MF: | C4H8O4 | | MW: | 120.1 | | EINECS: | 607-202-3 | | Product Categories: | Heterocycle-other series | | Mol File: | 23147-58-2.mol |  |
| | GLYCOLALDEHYDE DIMER Chemical Properties |
| Melting point | ~85 °C | | Boiling point | 312.4±42.0 °C(Predicted) | | density | 1.455 | | storage temp. | 2-8°C | | solubility | H2O: 0.1 g/mL, clear, colorless | | pka | 11.97±0.40(Predicted) | | form | crystalline | | color | White to Off-White | | BRN | 506029 | | InChI | InChI=1S/C4H8O4/c5-3-1-7-4(6)2-8-3/h3-6H,1-2H2 | | InChIKey | ATFVTAOSZBVGHC-UHFFFAOYSA-N | | SMILES | O1CC(O)OCC1O | | CAS DataBase Reference | 23147-58-2(CAS DataBase Reference) |
| WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | GLYCOLALDEHYDE DIMER Usage And Synthesis |
| Uses | Glycoaldehyde Dimer is derivative of glcoaldehyde, which is the precursor molecule of various significant compounds including amino acid glycine and in the formose reaction. | | Uses | Glycolaldehyde dimer may be used in the synthesis of 3,4-diaza-2-hexene-1,6-diol, which can undergo hydrogenation to form 1,2-bis(2-hydroxyethyl)hydrazine. It undergoes cycloaddition with 2,3-dihydrofuran in the presence of a chiral catalyst to form fused bicyclic tetrahydrofuran (bis-THF) alcohol, a key moiety of HIV protease inhibitors. | | Definition | ChEBI: Glycolaldehyde dimer is a member of dioxanes. |
| | GLYCOLALDEHYDE DIMER Preparation Products And Raw materials |
|