|
|
| | 2-Fluoro-N-methylaniline Basic information |
| | 2-Fluoro-N-methylaniline Chemical Properties |
| Boiling point | 87-88°C/20mm | | density | 1.1g/ml | | refractive index | 1.5340-1.5390 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | clear liquid | | pka | 3.65±0.10(Predicted) | | color | Colorless to Light yellow | | InChI | InChI=1S/C7H8FN/c1-9-7-5-3-2-4-6(7)8/h2-5,9H,1H3 | | InChIKey | LDVAIJZDACHGML-UHFFFAOYSA-N | | SMILES | C1(NC)=CC=CC=C1F | | CAS DataBase Reference | 1978-38-7(CAS DataBase Reference) |
| | 2-Fluoro-N-methylaniline Usage And Synthesis |
| Chemical Properties | Deep brown liquid | | Uses | 2-Fluoro-N-methylaniline is an aniline derivative used in the preparation of various pharmaceutical compounds such as muscarinic agonists. |
| | 2-Fluoro-N-methylaniline Preparation Products And Raw materials |
|