| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:N-Butylpyridinium chloride-d14
CAS:312623-96-4
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
CAS:312623-96-4
|
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
| Products Intro: |
|
|
| | 1-BUTYLPYRIDINIUM-D14 CHLORIDE Basic information |
| Product Name: | 1-BUTYLPYRIDINIUM-D14 CHLORIDE | | Synonyms: | 1-BUTYLPYRIDINIUM-D14 CHLORIDE;1-BUTYLPYRIDINIUM-D14 CHLORIDE, 98 ATOM % D;1-butylpyridinium chloride-d14;n-butylpyridinium chloride-d14;N-Butylpyridinium chloride-d14 | | CAS: | 312623-96-4 | | MF: | C9ClD14N | | MW: | 185.75 | | EINECS: | | | Product Categories: | | | Mol File: | 312623-96-4.mol |  |
| | 1-BUTYLPYRIDINIUM-D14 CHLORIDE Chemical Properties |
| Melting point | 131-133 °C(lit.) | | form | solid | | InChI | 1S/C9H14N.ClH/c1-2-3-7-10-8-5-4-6-9-10;/h4-6,8-9H,2-3,7H2,1H3;1H/q+1;/p-1/i1D3,2D2,3D2,4D,5D,6D,7D2,8D,9D; | | InChIKey | POKOASTYJWUQJG-CBZSTONXSA-M | | SMILES | [Cl-].[2H]c1c([2H])c([2H])[n+](c([2H])c1[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-21/22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-BUTYLPYRIDINIUM-D14 CHLORIDE Usage And Synthesis |
| | 1-BUTYLPYRIDINIUM-D14 CHLORIDE Preparation Products And Raw materials |
|