2-(N-Morpholino)ethanesulfonic acid potassium salt manufacturers
|
| | 2-(N-Morpholino)ethanesulfonic acid potassium salt Basic information |
| Product Name: | 2-(N-Morpholino)ethanesulfonic acid potassium salt | | Synonyms: | 2-[N-MORPHOLINO]ETHANE SULFONIC ACID POTASSIUM SALT;MES-K;2-(N-Morpholino)ethanesulfonic acid potassium salt, 4-Morpholineethanesulfonic acid potassium salt;MES, potassium salt 2-(N-Morpholino)ethanesulfonic acid, potassium salt;MES POTASSIUM;MES POTASSIUM SALT CRYSTALLINE;4-Morpholineethanesulfonic acid Potassium salt;MES-K) MES Potassi | | CAS: | 39946-25-3 | | MF: | C6H12KNO4S | | MW: | 233.33 | | EINECS: | | | Product Categories: | | | Mol File: | 39946-25-3.mol |  |
| | 2-(N-Morpholino)ethanesulfonic acid potassium salt Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | solubility | H2O: 0.35 g/mL, clear, colorless | | pka | 6.1 | | form | crystalline powder | | color | White to off-white | | PH Range | 5.5 - 6.7 | | PH | 5.5-6.7 | | Water Solubility | water: 0.33g/mL, clear, colorless | | InChI | 1S/C6H13NO4S.K/c8-12(9,10)6-3-7-1-4-11-5-2-7;/h1-6H2,(H,8,9,10);/q;+1/p-1 | | InChIKey | IMFIKFZWLAWMQE-UHFFFAOYSA-M | | SMILES | [K+].[O-]S(=O)(=O)CCN1CCOCC1 | | CAS DataBase Reference | 39946-25-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-37/39-26 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 2-(N-Morpholino)ethanesulfonic acid potassium salt Usage And Synthesis |
| Chemical Properties | White solid | | Uses | MES potassium salt has been used as a component of buffers for the preparation of permeabilized fiber bundles. | | Definition | ChEBI: The organic potassium salt that is the potassium salt of 2-(N-morpholino)ethanesulfonic acid. | | Biochem/physiol Actions | MES is applicable as a Good′s buffer and is widely used in regulating the pH of reagent solutions, physiological experiments and plant culture medium. |
| | 2-(N-Morpholino)ethanesulfonic acid potassium salt Preparation Products And Raw materials |
|