|
|
| | (R)-(-)-4-Methylbezenesulfinamide Basic information |
| | (R)-(-)-4-Methylbezenesulfinamide Chemical Properties |
| Melting point | 115-118 °C (lit.) | | Boiling point | 0°C | | density | 1.28±0.1 g/cm3(Predicted) | | Fp | 0°C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 9.52±0.40(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C7H9NOS/c1-6-2-4-7(5-3-6)10(8)9/h2-5H,8H2,1H3 | | InChIKey | YNJDSRPIGAUCEE-UHFFFAOYSA-N | | SMILES | S(C1C=CC(C)=CC=1)(=O)N |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2930909899 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-(-)-4-Methylbezenesulfinamide Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | (R)-(-)-p-Toluenesulfinamide is a reagent used for asymmetric synthesis of (+)-preussin from N-sulfinyl δ-amino β-ketoesters. |
| | (R)-(-)-4-Methylbezenesulfinamide Preparation Products And Raw materials |
|