|
|
| | 2-Chloro-4-cyanopyridine Basic information |
| | 2-Chloro-4-cyanopyridine Chemical Properties |
| Melting point | 69-73 °C(lit.) | | Boiling point | 104-106°C 15mm | | density | 1.33±0.1 g/cm3(Predicted) | | Fp | 104-106°C/15mm | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | -1.60±0.10(Predicted) | | color | White to Almost white | | BRN | 113927 | | InChI | InChI=1S/C6H3ClN2/c7-6-3-5(4-8)1-2-9-6/h1-3H | | InChIKey | QRXBTPFMCTXCRD-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC(C#N)=C1 | | CAS DataBase Reference | 33252-30-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36-36/37/39-36/37 | | RIDADR | 3276 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Chloro-4-cyanopyridine Usage And Synthesis |
| Chemical Properties | White to off-white solid | | Uses | 2-Chloro-4-cyanopyridine is an intermediate used to prepare pyrrolopyridine inhibitors of mitogen-activated protein kinase-activated protein kinase 2 (MK-2). It is also used to synthesize pyridinyl-tetrazoles as scaffold to identify matrix MMP-13 inhibitors for treatment of osteoarthritis. | | Materials Uses | 2-Chloro-4-cyanopyridine is employed in the formulation of advanced materials, including polymers and coatings, offering improved durability and chemical resistance compared to similar compounds. | | Synthesis | The general procedure for the synthesis of 2-chloro-4-cyanopyridine from 4-cyanopyridine N-oxide was as follows: 120 g of 4-cyanopyridine-N-oxide, 360 mL of 1,2-dichloroethane, and 183.6 g of phosphorochloridic acid were added sequentially in a 1000 mL three-necked reaction flask. After the reaction system was cooled to -2±2°C, 151.5 g of triethylamine was added slowly dropwise for a controlled dropwise time of 2 hours. After the dropwise addition, the reaction was continued at the same temperature with stirring for 2 hours. Upon completion of the reaction, the reaction solution was concentrated by reduced pressure distillation until no fractions flowed out. 240 mL of water was added to the concentrated solution and a large amount of solid was precipitated after thorough stirring. The solid was collected by filtration and the filter cake was washed with appropriate amount of water to obtain 117.5 g of white solid product 2-chloro-4-cyanopyridine. | | References | [1] Tetrahedron Letters, 2001, vol. 42, # 39, p. 6815 - 6818
[2] Patent: CN104945383, 2017, B. Location in patent: Paragraph 0031; 0035; 0036 |
| | 2-Chloro-4-cyanopyridine Preparation Products And Raw materials |
|