- Menthyl isovalerate
-
-
2026-06-30
- CAS:16409-46-4
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
|
| | Menthyl isovalerate Basic information |
| | Menthyl isovalerate Chemical Properties |
| Melting point | 1.3°C (estimate) | | Boiling point | 260-262 °C750 mm Hg(lit.) | | density | 0.909 g/mL at 25 °C(lit.) | | refractive index | 1.4486 | | FEMA | 2669 | MENTHYL ISOVALERATE | | Fp | >230 °F | | form | Liquid
(Density: 0.91±0.1 g/cm3) | | color | Colorless to light yellow | | Odor | at 100.00 %. fruity cooling sweet woody | | Odor Type | fruity | | Optical Rotation | [α]20/D 64°, neat | | JECFA Number | 432 | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C15H28O2/c1-10(2)8-15(16)17-14-9-12(5)6-7-13(14)11(3)4/h10-14H,6-9H2,1-5H3 | | InChIKey | VYQSSWZYPCCBRN-UHFFFAOYSA-N | | SMILES | C(OC1CC(C)CCC1C(C)C)(=O)CC(C)C | | LogP | 5.555 (est) | | EPA Substance Registry System | Butanoic acid, 3-methyl-, 5-methyl-2-(1-methylethyl)cyclohexyl ester (16409-46-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | OT0720000 | | TSCA | TSCA listed |
| | Menthyl isovalerate Usage And Synthesis |
| Description | Menthyl isovalerate has an odor similar to both menthol and isovaleric acid, sweet and herbaceous, somewhat balsamic or root-like.
It has a bitter, wood-like taste. Prepared by heating a mixture of
ι-menthol and isovaleric acid at 100 - 110°C in the presence of
trace concentrated H2SO4 or at 100°C in the presence of HCL. | | Chemical Properties | Menthyl isovalerate has an odor similar to both menthol and isovaleric acid, sweet and herbaceous. It has a bitter, wood like taste. | | Occurrence | Reported found in several peppermint essential oils: American, French, English, and Russian peppermint and
nutmeg | | Preparation | Prepared by heating a mixture of l-menthol and isovaleric acid at 100 to 110°C in the presence of trace concentrated
H2SO4 or at 100°C in the presence of HCl. | | Taste threshold values | Taste characteristics at 80 ppm: fruity, sweet, with a tutti-fruitti background. | | Hazard | Low toxicity by ingestion and skin contact.
A moderate skin contact irritant. |
| | Menthyl isovalerate Preparation Products And Raw materials |
|