| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(2R)-(?)-2-Methylglycidyl 4-nitrobenzoate CAS:106268-96-6 Purity:98% Package:1G
|
|
| | (2R)-(-)-2-METHYLGLYCIDYL 4-NITROBENZOATE Basic information |
| | (2R)-(-)-2-METHYLGLYCIDYL 4-NITROBENZOATE Chemical Properties |
| Melting point | 87-89 °C(lit.) | | Boiling point | 379.74°C (rough estimate) | | density | 1.3350 (rough estimate) | | refractive index | 1.5300 (estimate) | | storage temp. | 2-8°C | | solubility | soluble in Chloroform, DCM | | form | Solid | | color | Light Yellow | | Optical Rotation | [α]19/D 5.9°, c = 2.4 in chloroform | | InChI | InChI=1S/C11H12NO6/c1-11(5-13,6-18-11)9-4-7(12(16)17)2-3-8(9)10(14)15/h2-4,13H,5-6H2,1H3,(H,14,15) | | InChIKey | KBYNTFSZTDWVEU-UHFFFAOYSA-N | | SMILES | O1CC1(C)(C1=CC([N+]([O-])=O)=CC=C1C(O)=O)CO |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | RR0510300 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (2R)-(-)-2-METHYLGLYCIDYL 4-NITROBENZOATE Usage And Synthesis |
| Uses | (R)-(-)-2-Methylglycidyl 4-Nitrobenzoate is an intermediate in the synthesis of Delamanid (D230660), a novel anti-tuberculosis medication that inhibits mycolic acid synthesis and shows potent in-vitro and in-vivo activity against drug-resistant strains of Mycobacterium tuberculosis. |
| | (2R)-(-)-2-METHYLGLYCIDYL 4-NITROBENZOATE Preparation Products And Raw materials |
|