|
|
| | TRI-N-HEXYLCHLOROSILANE Basic information |
| | TRI-N-HEXYLCHLOROSILANE Chemical Properties |
| Boiling point | 153.5-154 °C/5 mmHg (lit.) | | density | 0.871 g/mL at 25 °C (lit.) | | refractive index | 1.4560 | | Fp | >110°C | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 0.871 | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | InChI | 1S/C18H39ClSi/c1-4-7-10-13-16-20(19,17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3 | | InChIKey | WZQSBCHNVPAYOC-UHFFFAOYSA-N | | SMILES | CCCCCC[Si](Cl)(CCCCCC)CCCCCC | | CAS DataBase Reference | 3634-67-1(CAS DataBase Reference) | | EPA Substance Registry System | Silane, chlorotrihexyl- (3634-67-1) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-28-27 | | RIDADR | 2987 | | WGK Germany | 1 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 2931900090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | TRI-N-HEXYLCHLOROSILANE Usage And Synthesis |
| Uses | Chlorotrihexylsilane is used as a surface modifier. It is used for enhanced dispersion of phosphor in polymeric matrix by using surface-modification |
| | TRI-N-HEXYLCHLOROSILANE Preparation Products And Raw materials |
|