|
|
| | (S)-(-)-3,3'-DIBROMO-1,1'-BI-2-NAPHTHOL Basic information |
| Product Name: | (S)-(-)-3,3'-DIBROMO-1,1'-BI-2-NAPHTHOL | | Synonyms: | (R)-3,3′-Dibromo-[1,1′-Binaphthalene]-2,2′-diol;(R)-Dibromo-1,1′-Bi-2,2′-naphthol;(R)-Dibromo-1,1′-Binaphthalene-2,2′-diol;(R)-Dibromo-1,1-Binaphthol;(R)-Dibromo-bi-2-naphthol;(R)-Dibromo-BINOL;(R)-(+)-3,3'-Dibromo-1,1'-bi-2-naphthol 97%;(R)-3,3'-Dibromo-1,1'-bi-2-naphthol, 99%e.e. | | CAS: | 111795-43-8 | | MF: | C20H12Br2O2 | | MW: | 444.12 | | EINECS: | | | Product Categories: | BINOL Series;Chiral Oxygen;chiral;Asymmetric Synthesis;Synthetic Organic Chemistry;BINOLs;Chiral Catalysts, Ligands, and Reagents;Privileged Ligands and Complexes | | Mol File: | 111795-43-8.mol |  |
| | (S)-(-)-3,3'-DIBROMO-1,1'-BI-2-NAPHTHOL Chemical Properties |
| Melting point | 256-260 °C | | alpha | +43° (c 0.22, CHCl3) | | Boiling point | 469.9±40.0 °C(Predicted) | | density | 1.761±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | within almost transparency in Methanol | | pka | 6.43±0.50(Predicted) | | form | Powder | | color | White to pale yellow-beige | | InChI | 1S/C20H12Br2O2/c21-15-9-11-5-1-3-7-13(11)17(19(15)23)18-14-8-4-2-6-12(14)10-16(22)20(18)24/h1-10,23-24H | | InChIKey | BRTBEAXHUYEXSY-UHFFFAOYSA-N | | SMILES | Brc1cc2c(c(c1O)c3c4c(cc(c3O)Br)cccc4)cccc2 |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39-37/39 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HS Code | 29081990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| | (S)-(-)-3,3'-DIBROMO-1,1'-BI-2-NAPHTHOL Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | (R)-(+)-3,3′-Dibromo-1,1′-bi-2-naphthol reacts with zirconium(IV) tert-butoxide to form a chiral zirconium complex, which can efficiently catalyze:
- anti-selective catalytic asymmetric aldol reactions of silyl enol ethers with aldehydes
- asymmetric intramolecular [3+2] cycloaddition of hydrazone/olefins
|
| | (S)-(-)-3,3'-DIBROMO-1,1'-BI-2-NAPHTHOL Preparation Products And Raw materials |
|