1-(2-MESITYLENE)-1,3-BUTANEDIONE manufacturers
|
| | 1-(2-MESITYLENE)-1,3-BUTANEDIONE Basic information |
| Product Name: | 1-(2-MESITYLENE)-1,3-BUTANEDIONE | | Synonyms: | (2,4,6-TRIMETHYLBENZOYL)ACETONE;1-(2,4,6-TRIMETHYLBENZENE)-1,3-BUTANEDIONE;1-(2-MESITYLENE)-1,3-BUTANEDIONE;Mesitylenebutanedione;1-(2-MESITYLENE)-1,3-BUTANEDIONE 96+%;Mesitoylacetone;1,3-Butanedione,1-(2,4,6-trimethylphenyl)-;1-(2,4,6-Trimethylbenzene)-1,3-butanedione
(2,4,6-Trimethylbenzoyl)acetone | | CAS: | 6450-57-3 | | MF: | C13H16O2 | | MW: | 204.27 | | EINECS: | | | Product Categories: | | | Mol File: | 6450-57-3.mol |  |
| | 1-(2-MESITYLENE)-1,3-BUTANEDIONE Chemical Properties |
| Melting point | 45°C | | Boiling point | 172 °C / 22mmHg | | density | 1.022±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at room temperature | | solubility | within almost transparency in Methanol | | form | powder to lump to clear liquid | | pka | 9.269±0.46(predicted) | | color | White or Colorless to Yellow | | InChI | InChI=1S/C13H16O2/c1-8-5-9(2)13(10(3)6-8)12(15)7-11(4)14/h5-6H,7H2,1-4H3 | | InChIKey | MBZZDUHWYNESIY-UHFFFAOYSA-N | | SMILES | C(C1=C(C)C=C(C)C=C1C)(=O)CC(=O)C |
| Safety Statements | 24/25 | | HS Code | 2914.39.9000 |
| | 1-(2-MESITYLENE)-1,3-BUTANEDIONE Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 75, p. 4109, 1953 DOI: 10.1021/ja01112a534 |
| | 1-(2-MESITYLENE)-1,3-BUTANEDIONE Preparation Products And Raw materials |
|