- 3,5-Dinitrobenzamide
-
- $53.02
-
2026-07-27
- CAS:121-81-3
- Min. Order: 25Kg/Drum
- Purity: 99.00%HPLC
- Supply Ability: 7tons/month
- Nitromide
-
- $68.00
-
2026-05-11
- CAS:121-81-3
- Purity: 99.84%
- Supply Ability: 10g
- Nitromide
-
- $68.00
-
2026-05-11
- CAS:121-81-3
- Purity: 99.84%
- Supply Ability: 10g
|
| | 3,5-Dinitrobenzamide Basic information |
| | 3,5-Dinitrobenzamide Chemical Properties |
| Melting point | 183-185 °C (lit.) | | Boiling point | 350.8°C (rough estimate) | | density | 1.6444 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Store at -20°C | | solubility | DMSO : ≥ 2.2 mg/mL (10.42 mM) | | pka | 13.73±0.50(Predicted) | | form | Solid | | color | Light yellow to yellow | | Merck | 14,6612 | | BRN | 7096825 | | InChI | 1S/C7H5N3O5/c8-7(11)4-1-5(9(12)13)3-6(2-4)10(14)15/h1-3H,(H2,8,11) | | InChIKey | UUKWKUSGGZNXGA-UHFFFAOYSA-N | | SMILES | NC(=O)c1cc(cc(c1)[N+]([O-])=O)[N+]([O-])=O | | CAS DataBase Reference | 121-81-3(CAS DataBase Reference) | | NIST Chemistry Reference | 3,5-Dinitrobenzamide(121-81-3) | | EPA Substance Registry System | 3,5-Dinitrobenzamide (121-81-3) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | CV4752300 | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3,5-Dinitrobenzamide Usage And Synthesis |
| Chemical Properties | light yellow powder | | Uses | antibacterial, coccidiostat | | Uses | 3,5-Dinitrobenzamide is used in method for continuously preparing Amides from Carboxylic Acids by Amidation. |
| | 3,5-Dinitrobenzamide Preparation Products And Raw materials |
|