|
|
| | OXAMIC ACID POTASSIUM SALT Basic information | | Uses |
| Product Name: | OXAMIC ACID POTASSIUM SALT | | Synonyms: | OXAMIC ACID POTASSIUM SALT;OXAMIDIC ACID POTASSIUM SALT;oxamicacidpotassium;2-Amino-2-oxoacetic acid potassium salt;Oxamic acid monopotassium salt;Oxamidic Acid Potassium Salt
Potassium Oxamate;Acetic acid, 2-amino-2-oxo-, potassium salt (1:1);Potassium 2-amino-2-oxoacetate | | CAS: | 21141-31-1 | | MF: | C2H2KNO3 | | MW: | 127.14 | | EINECS: | | | Product Categories: | | | Mol File: | 21141-31-1.mol |  |
| | OXAMIC ACID POTASSIUM SALT Chemical Properties |
| form | powder to crystal | | color | White to Almost white | | Water Solubility | almost transparency | | InChI | InChI=1S/C2H3NO3.K/c3-1(4)2(5)6;/h(H2,3,4)(H,5,6);/q;+1/p-1 | | InChIKey | PSLCBKISHMXGLT-UHFFFAOYSA-M | | SMILES | C(=O)(N)C([O-])=O.[K+] |
| | OXAMIC ACID POTASSIUM SALT Usage And Synthesis |
| Uses | Potassium oxalate is an organometallic compound that can be used in organic synthesis. |
| | OXAMIC ACID POTASSIUM SALT Preparation Products And Raw materials |
|