|
|
| | 4-(difluoromethylidene)piperidine hydrochloride Basic information |
| | 4-(difluoromethylidene)piperidine hydrochloride Chemical Properties |
| storage temp. | Store at room temperature, keep dry and cool | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H9F2N.ClH/c7-6(8)5-1-3-9-4-2-5;/h9H,1-4H2;1H | | InChIKey | RGXCXVJYDBNGMU-UHFFFAOYSA-N | | SMILES | C(=C1CCNCC1)(F)F.Cl |
| | 4-(difluoromethylidene)piperidine hydrochloride Usage And Synthesis |
| Uses | 4-(Difluoromethylene)piperidine Hydrochloride is a useful reagent in the preparation of SSR182289A, a selective and potent orally active thrombin inhibitor. |
| | 4-(difluoromethylidene)piperidine hydrochloride Preparation Products And Raw materials |
|