| Company Name: |
Shanghai Fuorain BioTech Co., Ltd Gold
|
| Tel: |
18672534757 |
| Email: |
xiaoxue.hu@fuorain.cn |
| Products Intro: |
Product Name:5-HEX CAS:155911-15-2 Purity:>98% Package:100mg;500mg;1g;5g;按客戶需求分包裝
|
| Company Name: |
Okeanos Tech Co,. Ltd.
|
| Tel: |
010-62651721 18610486005 |
| Email: |
minghui.yu@okeanos.com.cn |
| Products Intro: |
Product Name:5-HEX;HEX809 CAS:155911-15-2 Purity:97% HPLC Package:1g;5g;10g;25g;50g;100g,500g
|
| Company Name: |
Henan Alpha Chemical Co., Ltd.
|
| Tel: |
0371-55055611 18137792234 |
| Email: |
3957071458@qq.com |
| Products Intro: |
Product Name:5-HEX CAS:155911-15-2 Purity:98% Package:1g;5g;10g;25g;100g;500g;1kg;5kg
|
| Company Name: |
Commlink Technology (Tianjin)Co.,Ltd
|
| Tel: |
13363078196 18611514899 |
| Email: |
Commlink2024@126.com |
| Products Intro: |
Product Name:5-Carboxy-4,7,2',4',5',7'-hexachlorofluorescein;5-HEX; CAS:155911-15-2 Purity:HPLC:97% Package:1g;10g;100g
|
|
| | 5-Carboxy-4,7,2',4',5',7'-hexachlorofluorescein Basic information | | Uses |
| Product Name: | 5-Carboxy-4,7,2',4',5',7'-hexachlorofluorescein | | Synonyms: | 5-Carboxy-4,7,2',4',5',7'-hexachlorofluorescein;HEX809;Spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-5-carboxylic acid, 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-3-oxo-;5-HEX | | CAS: | 155911-15-2 | | MF: | C21H6Cl6O7 | | MW: | 582.99 | | EINECS: | | | Product Categories: | | | Mol File: | 155911-15-2.mol |  |
| | 5-Carboxy-4,7,2',4',5',7'-hexachlorofluorescein Chemical Properties |
| Boiling point | 785.8±60.0 °C(Predicted) | | density | 2.06±0.1 g/cm3(Predicted) | | pka | 1.87±0.20(Predicted) | | InChI | InChI=1S/C21H6Cl6O7/c22-7-1-4(19(30)31)12(25)10-11(7)21(34-20(10)32)5-2-8(23)15(28)13(26)17(5)33-18-6(21)3-9(24)16(29)14(18)27/h1-3,28-29H,(H,30,31) | | InChIKey | KZCRVHZQAGAFID-UHFFFAOYSA-N | | SMILES | C12(C3=C(C(Cl)=C(O)C(Cl)=C3)OC3=C1C=C(Cl)C(O)=C3Cl)C1=C(C(Cl)=C(C(O)=O)C=C1Cl)C(=O)O2 |
| | 5-Carboxy-4,7,2',4',5',7'-hexachlorofluorescein Usage And Synthesis |
| Uses | Hexachloro-5-carboxyfluorescein is a fluorescent dye widely used in biomedical research and chemical analysis. |
| | 5-Carboxy-4,7,2',4',5',7'-hexachlorofluorescein Preparation Products And Raw materials |
|