- Diacetolol
-
-
2026-07-15
- CAS:22568-64-5
- Purity:
- Supply Ability: 10g
|
| | (±)-N-[3-acetyl-4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]acetamide Basic information |
| | (±)-N-[3-acetyl-4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]acetamide Chemical Properties |
| Melting point | 128 - 131°C | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Very Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Light Yellow | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C16H24N2O4/c1-10(2)17-8-14(21)9-22-16-6-5-13(18-12(4)20)7-15(16)11(3)19/h5-7,10,14,17,21H,8-9H2,1-4H3,(H,18,20) | | InChIKey | AWOGXJOBNAWQSF-UHFFFAOYSA-N | | SMILES | N(C(C)C)CC(O)COc1c(cc(cc1)NC(=O)C)C(=O)C |
| WGK Germany | WGK 3 | | HS Code | 2933599550 | | Storage Class | 11 - Combustible Solids |
| | (±)-N-[3-acetyl-4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]acetamide Usage And Synthesis |
| Uses | The principal metabolite of Acebutolol (A123800) with less β-adrenoceptor blocking potency but greater cardioselectivity (atrial relative to tracheal tissue. Acebutolol EP Impurity B. |
| | (±)-N-[3-acetyl-4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]acetamide Preparation Products And Raw materials |
|