|
|
| | Methyl 2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate Basic information |
| | Methyl 2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate Chemical Properties |
| Melting point | 253-254 °C | | Boiling point | 76-78°C 0,5mm | | density | 1.491 | | refractive index | n20/D1.468 | | Fp | >110℃ | | storage temp. | 2-8°C | | pka | -5.70±0.29(Predicted) | | form | liquid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C7H4ClF3N2O2/c1-15-5(14)3-2-12-6(8)13-4(3)7(9,10)11/h2H,1H3 | | InChIKey | VLUBJYUOPNGBOQ-UHFFFAOYSA-N | | SMILES | COC(=O)c1cnc(Cl)nc1C(F)(F)F | | CAS DataBase Reference | 175137-27-6(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22-22 | | Safety Statements | 26-36/37/39-23-51-24/25-22 | | RIDADR | UN 2810 6.1 / PGIII | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933599590 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Methyl 2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate Usage And Synthesis |
| Uses | Methyl 2-Chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate is used in the synthetic preparation and discovery of 2-[(2,4-Dichlorophenyl)amino]-N-[(tetrahydro- 2H-pyran-4-yl)methyl]-4-(trifluoromethyl)- 5-pyrimidinecarboxamide (G931520) which is a highly selective CB2 receptor agonist for the treatment of inflammatory and neuropathic pain. |
| | Methyl 2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate Preparation Products And Raw materials |
|