- Tamsulosin hydrochloride
-
- $99.99
-
2022-02-24
- CAS:80223-99-0
- Min. Order: 10g
- Purity: 99.99%HPLC.USP42——Powder、Oil、Pills、Capsules、Tablets，Customiz
- Supply Ability: 1000kgs
|
| | Tamsulosin hydrochloride Basic information |
| | Tamsulosin hydrochloride Chemical Properties |
| Melting point | 254-256 °C | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C20H28N2O5S.ClH/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24;/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24);1H | | InChIKey | ZZIZZTHXZRDOFM-UHFFFAOYSA-N | | SMILES | O=S(C1=C(OC)C=CC(CC(NCCOC2=C(OCC)C=CC=C2)C)=C1)(N)=O.[H]Cl |
| | Tamsulosin hydrochloride Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | Tamsulosin hydrochloride is a specific ;1-adrenoceptor antagonist. Used in the treatment of benign prostatic hypertrophy. | | Uses | Tamsulosin is a specific α1-adrenoceptor antagonist. Used in the treatment of benign prostatic hypertrophy. | | Clinical Use | Treatment of benign prostatic hyperplasia | | Drug interactions | Potentially hazardous interactions with other drugs
Anaesthetics: enhanced hypotensive effect.
Antidepressants: enhanced hypotensive effect with
MAOIs.
Antifungals: concentration increased by
ketoconazole.
Avanafil, vardenafil, sildenafil and tadalafil: enhanced
hypotensive effect, avoid concomitant use.
Beta-blockers: enhanced hypotensive effect;
increased risk of first dose hypotensive effect.
Calcium-channel blockers: enhanced hypotensive
effect; increased risk of first dose hypotensive effect.
Diuretics: enhanced hypotensive effect; increased
risk of first dose hypotensive effect.
Moxisylyte: possibly severe postural hypotension. | | Metabolism | Tamsulosin is metabolised slowly in the liver primarily
by the cytochrome P450 isoenzymes CYP2D6 and
CYP3A4; it is excreted mainly in the urine as metabolites
and some unchanged drug |
| | Tamsulosin hydrochloride Preparation Products And Raw materials |
|