|
|
| | 2-CHLORO-4-METHYLBENZONITRILE Basic information |
| Product Name: | 2-CHLORO-4-METHYLBENZONITRILE | | Synonyms: | 2-Chloro-4-methylbenzonitrile;2-Chloro-4-methylbenzonitrile 98+%;3-Chloro-4-cyanotoluene;Benzonitrile, 2-chloro-4-Methyl-;3-Chloro-4-cyanotoluene, 2-Chloro-p-tolunitrile;2-Chloro-4-Methylbenzonitrile, 97%+ | | CAS: | 21423-84-7 | | MF: | C8H6ClN | | MW: | 151.59 | | EINECS: | | | Product Categories: | | | Mol File: | 21423-84-7.mol |  |
| | 2-CHLORO-4-METHYLBENZONITRILE Chemical Properties |
| Melting point | 51-55 °C | | Boiling point | 269.7±20.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | crystalline powder | | color | Off-white | | InChI | InChI=1S/C8H6ClN/c1-6-2-3-7(5-10)8(9)4-6/h2-4H,1H3 | | InChIKey | LKWQNMIDLFGETG-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(C)C=C1Cl |
| | 2-CHLORO-4-METHYLBENZONITRILE Usage And Synthesis |
| Chemical Properties | off-white Crysstalline |
| | 2-CHLORO-4-METHYLBENZONITRILE Preparation Products And Raw materials |
|