4-Difluoromethyl-phenylboronic acid manufacturers
|
| | 4-Difluoromethyl-phenylboronic acid Basic information |
| | 4-Difluoromethyl-phenylboronic acid Chemical Properties |
| Boiling point | 287℃ | | density | 1.27 | | Fp | 127℃ | | storage temp. | Inert atmosphere,2-8°C | | pka | 8.36±0.17(Predicted) | | form | crystalline powder | | color | White | | InChI | InChI=1S/C7H7BF2O2/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4,7,11-12H | | InChIKey | BKHBDGFRIWAUKK-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(C(F)F)C=C1)(O)O |
| | 4-Difluoromethyl-phenylboronic acid Usage And Synthesis |
| Uses | 4-Difluoromethylphenylboronic acid |
| | 4-Difluoromethyl-phenylboronic acid Preparation Products And Raw materials |
|