|
|
| | 2-(3-BROMOPHENYL)PYRIDINE
Basic information |
| | 2-(3-BROMOPHENYL)PYRIDINE
Chemical Properties |
| Boiling point | 311.9±17.0 °C(Predicted) | | density | 1.426±0.06 g/cm3(Predicted) | | refractive index | gt. 1.6480 to 1.6520 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | pka | 4.04±0.12(Predicted) | | color | White to Yellow to Green | | InChI | InChI=1S/C11H8BrN/c12-10-5-3-4-9(8-10)11-6-1-2-7-13-11/h1-8H | | InChIKey | WLPFTJXVEBANAM-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC(Br)=C2)=NC=CC=C1 |
| | 2-(3-BROMOPHENYL)PYRIDINE
Usage And Synthesis |
| Description | 2-(3-Bromophenyl)pyridine is an organic synthesis intermediate with wide applications and can also be used as an important intermediate in the preparation of pesticides and insecticides. | | Chemical Properties | light yellow liquid |
| | 2-(3-BROMOPHENYL)PYRIDINE
Preparation Products And Raw materials |
|