|
|
| | Heptafluorobutyryl chloride Basic information |
| Product Name: | Heptafluorobutyryl chloride | | Synonyms: | 2,2,3,3,4,4,4-Heptafluorobutanoyl chloride;Butanoyl chloride, heptafluoro-;Butanoylchloride,heptafluoro-;Heptafluorobutyrylchloride,97%;HEPTAFLUOROBUTYRYL CHLORIDE;HEPTAFLUORO-N-BUTYRYL CHLORIDE;HEPTAFLUOROBUTYRIC ACID CHLORIDE;HEPTAFLUOROBUTANOYL CHLORIDE | | CAS: | 375-16-6 | | MF: | C4ClF7O | | MW: | 232.48 | | EINECS: | 206-785-8 | | Product Categories: | | | Mol File: | 375-16-6.mol |  |
| | Heptafluorobutyryl chloride Chemical Properties |
| Melting point | 59-61 °C(Solv: benzene (71-43-2)) | | Boiling point | 39 °C | | density | 1.556 g/mL at 20 °C | | vapor pressure | 7.22 psi ( 20 °C) | | refractive index | 1.286-1.294 | | Fp | 38-39°C | | storage temp. | 2-8°C | | form | Liquid | | color | Clear colorless | | Specific Gravity | 1.556 | | Water Solubility | decomposes | | Sensitive | Lachrymatory | | BRN | 1790269 | | InChI | 1S/C4ClF7O/c5-1(13)2(6,7)3(8,9)4(10,11)12 | | InChIKey | WFELVFKXQJYPSL-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(Cl)=O | | CAS DataBase Reference | 375-16-6(CAS DataBase Reference) | | NIST Chemistry Reference | Heptafluorobutyryl chloride(375-16-6) | | EPA Substance Registry System | Butanoyl chloride, heptafluoro- (375-16-6) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 45-36/37/39-26 | | RIDADR | 3265 | | WGK Germany | 3 | | Hazard Note | Corrosive/Lachrymatory | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29159080 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Heptafluorobutyryl chloride Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | GC reagent. |
| | Heptafluorobutyryl chloride Preparation Products And Raw materials |
|