- (+)-AROMADENDRENE
-
-
2025-06-27
- CAS:489-39-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- (+)-AROMADENDRENE
-
- $30.00
-
2025-06-20
- CAS:489-39-4
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10 tons
|
| | (+)-AROMADENDRENE Basic information |
| Product Name: | (+)-AROMADENDRENE | | Synonyms: | 1H-Cycloprop[e]azulene, decahydro-1,1,7-trimethyl-4-methylene-, (1aR,4aR,7R,7aR,7bS)-(+)-;(1R,2S,8R,11R)-7-METHYLENE-3,3,11-TRIMETHYL-TRICYCLO[6.3.0.0(2.4)]UNDECANE;(+)-AROMADENDRENE;AROMADENDRENE, (+);aromadendrene,aromadendrene,[1ar-(1aalpha,4aalpha,7alpha,7abeta,7balpha)]-decahydro-1,1,7-trimethyl-4-methylene-1H-cycloprop[e]azulene;AROMADENDRENE, (+)-(SG);(+)-AROMADENDRENE WITH GC;(1aβ,4aβ,7aα,7bβ)-Decahydro-4-methylene-1,1,7β-trimethyl-1H-cyclopropa[e]azulene | | CAS: | 489-39-4 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | 207-694-6 | | Product Categories: | | | Mol File: | 489-39-4.mol |  |
| | (+)-AROMADENDRENE Chemical Properties |
| Melting point | 262°C | | Boiling point | 261-263 °C (lit.) | | density | 0.912 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.497 | | Fp | 90℃ | | storage temp. | 2-8°C | | solubility | Chloroform (Soluble), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless to Pale Yellow | | Optical Rotation | [α]20/D +12±1°, neat | | BRN | 2554306 | | InChI | 1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h10-14H,1,5-8H2,2-4H3/t10-,11+,12-,13-,14-/m1/s1 | | InChIKey | ITYNGVSTWVVPIC-XVIXHAIJSA-N | | SMILES | [H][C@@]12CC[C@@H](C)[C@@]1([H])[C@@]3([H])[C@@]([H])(CCC2=C)C3(C)C | | LogP | 6.427 (est) |
| WGK Germany | 3 | | F | 10-23 | | Storage Class | 10 - Combustible liquids |
| | (+)-AROMADENDRENE Usage And Synthesis |
| Uses | (+)-Aromadendrene may be used as a chiral starting material to synthesize other sesquiterenes such as (-)-apoaromadendrone, (-)-kessane, (+)-spathulenol, (+)-ledene and (-)-isoledene. | | General Description | (+)-Aromadendrene, a sesquiterpenoid, is the major constituent of the essential oil of Eucalypfus globulus. |
| | (+)-AROMADENDRENE Preparation Products And Raw materials |
| Preparation Products | 1H-Cycloprop[e]azulen-4-ol, 1a,2,3,4,6,7,7a,7b-octahydro-1,1,4,7-tetramethyl-, (1aR,4S,7R,7aS,7bR)- |
|