N,N-DIISOPROPYLBENZAMIDE manufacturers
|
| | N,N-DIISOPROPYLBENZAMIDE Basic information |
| | N,N-DIISOPROPYLBENZAMIDE Chemical Properties |
| Melting point | 69-71 °C(lit.) | | Boiling point | 148-152°C 18mm | | density | 0.9923 (rough estimate) | | refractive index | 1.5175 (estimate) | | Fp | 148-152°C/18mm | | storage temp. | Sealed in dry,Room Temperature | | pka | -1.26±0.70(Predicted) | | Appearance | White to off-white Solid | | Water Solubility | Soluble in water 301 mg/L @ 25°C. | | BRN | 2048090 | | InChI | 1S/C13H19NO/c1-10(2)14(11(3)4)13(15)12-8-6-5-7-9-12/h5-11H,1-4H3 | | InChIKey | UYXMMJPYFKRKKM-UHFFFAOYSA-N | | SMILES | CC(C)N(C(C)C)C(=O)c1ccccc1 | | CAS DataBase Reference | 20383-28-2(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2924297099 | | Storage Class | 13 - Non Combustible Solids |
| | N,N-DIISOPROPYLBENZAMIDE Usage And Synthesis |
| | N,N-DIISOPROPYLBENZAMIDE Preparation Products And Raw materials |
|