3,5-DIISOPROPYLSALICYLIC ACID manufacturers
|
| | 3,5-DIISOPROPYLSALICYLIC ACID Basic information |
| Product Name: | 3,5-DIISOPROPYLSALICYLIC ACID | | Synonyms: | 3,5-DIISOPROPYLSALICYLIC ACID;3,5-Diisopropyl-2-hydroxybenzoic acid,3,5-Diisopropylsalicylic acid;3,5-Diisopropylsalicylic acid,98%;2-Hydroxy-3,5-diisopropylbenzoic acid;3,5-Diisopropyl-2-hydroxybenzoic acid;3,5-Di-#niso-propyl-2-hydroxybenzoic acid;3,5-DIISOPROPYLSALICYLATE;3,5-DIISOPROPYLSALICYCLICACID | | CAS: | 2215-21-6 | | MF: | C13H18O3 | | MW: | 222.28 | | EINECS: | 218-677-8 | | Product Categories: | Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts | | Mol File: | 2215-21-6.mol |  |
| | 3,5-DIISOPROPYLSALICYLIC ACID Chemical Properties |
| Melting point | 113-115 °C (lit.) | | Boiling point | 303.46°C (rough estimate) | | density | 1.1205 (rough estimate) | | refractive index | 1.4740 (estimate) | | storage temp. | 4°C | | solubility | Soluble in organic solvents. | | form | Solid | | pka | 3.21±0.14(Predicted) | | color | White to Off-White | | BRN | 2505176 | | InChI | 1S/C13H18O3/c1-7(2)9-5-10(8(3)4)12(14)11(6-9)13(15)16/h5-8,14H,1-4H3,(H,15,16) | | InChIKey | XUFUYOGWFZSHGE-UHFFFAOYSA-N | | SMILES | CC(C)c1cc(C(C)C)c(O)c(c1)C(O)=O | | CAS DataBase Reference | 2215-21-6(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2-hydroxy-3,5-bis(1-methylethyl)- (2215-21-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37 | | Safety Statements | 22-26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29182900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
STOT SE 3 |
| | 3,5-DIISOPROPYLSALICYLIC ACID Usage And Synthesis |
| Chemical Properties | beige to grey crystalline powder | | Uses | 3,5-Diisopropyl-2-hydroxybenzoic acid was used as starting reagent in the synthesis of Zn(II) and Cd(II) carboxylate complexes. | | Uses | 3,5-Diisopropylsalicylic acid is used to prepare 2,4-Diisopropyl-phenol at 200°C. It is also used as a starting reagent in the synthesis of Zn(II) and Cd(II) carboxylate complexes. It plays the role of OH-inactivating ligand in its complexes with copper(II)2. | | General Description | 3,5-Diisopropyl-2-hydroxybenzoic acid plays the role of OH-inactivating ligand in its complexes with copper(II). |
| | 3,5-DIISOPROPYLSALICYLIC ACID Preparation Products And Raw materials |
|