| Company Name: |
Yurui (Shanghai) Chemical Co., Ltd.
|
| Tel: |
02150456736 18602143071 |
| Email: |
Jenny@riyngroup.com |
| Products Intro: |
Product Name:2-(Methoxymethyl)tricyclo[3.3.1.13,7]dec-2-yl 2-methyl-2-propenoate CAS:1154655-97-6 Purity:98% Remarks:1kg
|
| Company Name: |
Hunan chemfish Scientific co.,ltd
|
| Tel: |
85567275 15707487186 |
| Email: |
sales06@chemfish.com |
| Products Intro: |
Product Name:2-(Methoxymethyl)tricyclo[3.3.1.13.7]dec-2-y 2-methy-2-propenoate CAS:1154655-97-6 Package:1kg
|
2-(Methoxymethyl)tricyclo[3.3.1.13,7]dec-2-yl 2-methyl-2-propenoate manufacturers
|
| | 2-(Methoxymethyl)tricyclo[3.3.1.13,7]dec-2-yl 2-methyl-2-propenoate Basic information |
| | 2-(Methoxymethyl)tricyclo[3.3.1.13,7]dec-2-yl 2-methyl-2-propenoate Chemical Properties |
| Boiling point | 331.7±15.0 °C(predicted) | | density | 1.08±0.1 g/cm3(Temp: 20 °C; Press: 760 Torr)(predicted) | | InChI | InChI=1S/C16H24O3/c1-10(2)15(17)19-16(9-18-3)13-5-11-4-12(7-13)8-14(16)6-11/h11-14H,1,4-9H2,2-3H3 | | InChIKey | TVZHHIPXWVDJQA-UHFFFAOYSA-N | | SMILES | O(C1(C2CC3CC(C2)CC1C3)COC)C(=O)C(=C)C |
| | 2-(Methoxymethyl)tricyclo[3.3.1.13,7]dec-2-yl 2-methyl-2-propenoate Usage And Synthesis |
| Uses | 2-(Methoxymethyl)tricyclo[3.3.1.13,7]dec-2-yl 2-methyl-2-propenoate is widely used in the preparation of high-end semiconductor photoresists.
|
| | 2-(Methoxymethyl)tricyclo[3.3.1.13,7]dec-2-yl 2-methyl-2-propenoate Preparation Products And Raw materials |
|