|
|
| | tert-Butyldiphenylsilyl Trifluoromethanesulfonate Basic information |
| Product Name: | tert-Butyldiphenylsilyl Trifluoromethanesulfonate | | Synonyms: | TERT-BUTYLDIPHENYLSILYL TRIFLATE);tert-butyldiphenylsilyl trifluoromethanesulfonate;tert-Butyldiphenylsilyl Triflate
Trifluoromethanesulfonic Acid tert-Butyldiphenylsilyl Ester;Methanesulfonic acid, trifluoro-, (1,1-diMethylethyl)diphenylsilyl ester;tert-Butyl(diphenyl)silyl trifluoromethanesulphonate;Methanesulfonic acid,1,1,1-trifluoro-, (1,1-dimethylethyl)diphenylsilyl ester;t-Butyldiphenylsilyl Trifluoromethanesulfonate;tert-Butyldiphenylsilyl Trifluoromethanesulfonate | | CAS: | 92886-86-7 | | MF: | C17H19F3O3SSi | | MW: | 388.48 | | EINECS: | | | Product Categories: | | | Mol File: | 92886-86-7.mol |  |
| | tert-Butyldiphenylsilyl Trifluoromethanesulfonate Chemical Properties |
| Boiling point | 125 °C(Press: 0.02 Torr) | | density | 1.25±0.1 g/cm3(Predicted) | | Fp | 179° | | storage temp. | Inert atmosphere,2-8°C | | form | clear liquid | | color | Colorless to Brown | | InChI | InChI=1S/C17H19F3O3SSi/c1-16(2,3)25(14-10-6-4-7-11-14,15-12-8-5-9-13-15)23-24(21,22)17(18,19)20/h4-13H,1-3H3 | | InChIKey | AOMOJFWVOHXBTN-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)S(O[Si](C(C)(C)C)(C1=CC=CC=C1)C1=CC=CC=C1)(=O)=O |
| RIDADR | 1760 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29319090 |
| | tert-Butyldiphenylsilyl Trifluoromethanesulfonate Usage And Synthesis |
| Uses | Tert-Butyldiphenylsilyl Trifluoromethanesulfonate acts as an effective additive for high-voltage lithium metal batteries.1 | | Advantages | Tert-Butyldiphenylsilyl Trifluoromethanesulfonate can be preferentially reduced on the surface of the lithium anode to form a flat and dense SEI layer, which further inhibits the consumption of the electrolyte and improves the electrochemical reversibility during the lithium plating/stripping process. | | References |
[1] Zhou, H., Li, T., Liu, W., Guo, Z., Guo, Y., Gao, J., Qu, M., Zhang, H., & Peng, G. (2022). [tert-Butyl(diphenyl)silyl] trifluoromethanesulfonate acts as an effective additive for high-voltage lithium metal batteries?. Materials Chemistry Frontiers, 16, 2274–2283. https://doi.org/10.1039/D2QM00481J
|
| | tert-Butyldiphenylsilyl Trifluoromethanesulfonate Preparation Products And Raw materials |
|