|
|
| | 4'-METHYLBIPHENYL-4-CARBOXYLIC ACID Basic information |
| | 4'-METHYLBIPHENYL-4-CARBOXYLIC ACID Chemical Properties |
| Melting point | 252-253°C | | Boiling point | 381.4±21.0 °C(Predicted) | | density | 1.156±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.23±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H12O2/c1-10-2-4-11(5-3-10)12-6-8-13(9-7-12)14(15)16/h2-9H,1H3,(H,15,16) | | InChIKey | RZOCCLOTCXINRG-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C)C=C2)=CC=C(C(O)=O)C=C1 | | CAS DataBase Reference | 720-73-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 4'-METHYLBIPHENYL-4-CARBOXYLIC ACID Usage And Synthesis |
| Uses | The 4'-methyl-biphenyl-4-carboxylic acid exhibits the characteristic absorption bands of COOH and CH, groups. Photoproduct analysis, carried out by GC-MS, ETIR and GC-FTIR confirm three successive oxidation states of methyl suhstituents such as alcohol, aldehyde and carboxylic acids. |
| | 4'-METHYLBIPHENYL-4-CARBOXYLIC ACID Preparation Products And Raw materials |
|