|
|
| | 2,4-DIMETHOXY-THIOBENZAMIDE Basic information |
| Product Name: | 2,4-DIMETHOXY-THIOBENZAMIDE | | Synonyms: | 4-(3,4-Dichloro-benzoylamino)-1-methyl-1H-pyrrole-;2,4-DIMETHOXYBENZENECARBOTHIOAMIDE;2,4-DIMETHOXY-THIOBENZAMIDE;2,4-dimethoxybenzene-1-carbothioamide;Benzenecarbothioamide, 2,4-dimethoxy- | | CAS: | 23822-07-3 | | MF: | C9H11NO2S | | MW: | 197.25 | | EINECS: | | | Product Categories: | | | Mol File: | 23822-07-3.mol |  |
| | 2,4-DIMETHOXY-THIOBENZAMIDE Chemical Properties |
| Boiling point | 342.8±52.0 °C(Predicted) | | density | 1.202±0.06 g/cm3(Predicted) | | pka | 12.41±0.29(Predicted) | | form | solid | | InChI | 1S/C9H11NO2S/c1-11-6-3-4-7(9(10)13)8(5-6)12-2/h3-5H,1-2H3,(H2,10,13) | | InChIKey | KYGPUPQKDUNOLW-UHFFFAOYSA-N | | SMILES | S=C(N)C1=C(OC)C=C(OC)C=C1 | | CAS DataBase Reference | 23822-07-3(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
| | 2,4-DIMETHOXY-THIOBENZAMIDE Usage And Synthesis |
| | 2,4-DIMETHOXY-THIOBENZAMIDE Preparation Products And Raw materials |
|