(R)-2,4-Dihydroxy-3,3-dimethylbutyric acid sodium salt manufacturers
|
| | (R)-2,4-Dihydroxy-3,3-dimethylbutyric acid sodium salt Basic information |
| Product Name: | (R)-2,4-Dihydroxy-3,3-dimethylbutyric acid sodium salt | | Synonyms: | (+)-Sodium pantoate;(R)-2,4-Dihydroxy-3,3-dimethylbutyric acid sodium salt;[R,(+)]-2,4-Dihydroxy-3,3-dimethylbutyric acid sodium salt;Pantoic acid sodium;[S,(-)]-2,4-Dihydroxy-3,3-dimethylbutyric acid sodium salt;sodium:(2R)-2,4-dihydroxy-3,3-dimethylbutanoate;Dexpanthenol Impurity 2;Dexpanthenol Impurity 1 Sodium Salt | | CAS: | 60979-68-2 | | MF: | C{6}H{11}NaO{4} | | MW: | 172.16 | | EINECS: | | | Product Categories: | Aliphatics, Metabolites & Impurities, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 60979-68-2.mol |  |
| | (R)-2,4-Dihydroxy-3,3-dimethylbutyric acid sodium salt Chemical Properties |
| Melting point | 167-171oC | | storage temp. | -20°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White | | Optical Rotation | [α]/D 8.0±1.0°, c = 1 in H2O | | BRN | 6119584 | | Stability: | Hygroscopic | | InChI | InChI=1/C6H12O4.Na.H/c1-6(2,3-7)4(8)5(9)10;;/h4,7-8H,3H2,1-2H3,(H,9,10);;/t4-;;/s3 | | InChIKey | HNABZQVLZRELML-FPXZQKKRNA-N | | SMILES | C(C)(C)(CO)[C@@H](O)C(=O)O.[NaH] |&1:5,r| |
| WGK Germany | WGK 3 | | HS Code | 2918195000 | | Storage Class | 11 - Combustible Solids |
| | (R)-2,4-Dihydroxy-3,3-dimethylbutyric acid sodium salt Usage And Synthesis |
| Uses | (R)-Pantoic Acid Sodium Salt is the derivative of Pantothenic (P190300) and γ-Aminobutyric Acids (A602920), which has shown to have some effect like depressing motor and aggressive behavior, hyperactivity, and body temperature. | | Uses | (R)-Pantoic Acid Sodium Salt, is the derivative of Pantothenic (P190300) and γ-Aminobutyric Acids (A602920), which has shown to have some effect like depressing motor and aggressive behavior, hyperactivity, and body temperature. | | Biochem/physiol Actions | (R)-Pantoic acid is an intermediate in the phosphopantothenate biosynthesis pathway for the de novo synthesis of R-pantothenate (vitamin B5) from valine in plants and microorganisms. |
| | (R)-2,4-Dihydroxy-3,3-dimethylbutyric acid sodium salt Preparation Products And Raw materials |
|