- 7-Hydroxygranisetron
-
- $1.00
-
2026-07-24
- CAS:4498-67-3
- Min. Order: 1ASSAYS
- Purity: 99%
- Supply Ability: 1000kg
- 7-Hydroxygranisetron
-
- $500.00
-
2026-07-24
- CAS:4498-67-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 5000
|
| | Indazole-3-carboxylic acid Basic information |
| | Indazole-3-carboxylic acid Chemical Properties |
| Melting point | 266-270 °C (dec.) | | Boiling point | 443.7±18.0 °C(Predicted) | | density | 1.506±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | powder | | pka | 3.03±0.10(Predicted) | | color | beige | | BRN | 6354 | | InChI | InChI=1S/C8H6N2O2/c11-8(12)7-5-3-1-2-4-6(5)9-10-7/h1-4H,(H,9,10)(H,11,12) | | InChIKey | BHXVYTQDWMQVBI-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C(C(O)=O)=N1 | | CAS DataBase Reference | 4498-67-3(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36-36/37/38 | | Safety Statements | 26-36/37/39-22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | Indazole-3-carboxylic acid Usage And Synthesis |
| Chemical Properties | yellow crystal | | Uses | Indazole-3-carboxylic acid may be used in the synthesis of the following:
- N-(8-methyl-azabicyclo[3.2.11]oct-3-yl)-1H-indazole-3-carboxamide
- N-(1- benzyl-4-methylhexahydro-1H-1,4-diazepin-6-yl)-1H-indazole-3-carboxamide
- 1H-indazole-3-carboxamide
| | Uses | Indazole-3-carboxylic acid is indole derivatives useful in treatment of pain and inflammation | | Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 26, p. 531, 1989 DOI: 10.1002/jhet.5570260251 |
| | Indazole-3-carboxylic acid Preparation Products And Raw materials |
|