|
|
| | 3-BROMO-4-(TRIFLUOROMETHOXY)ANILINE Basic information |
| Product Name: | 3-BROMO-4-(TRIFLUOROMETHOXY)ANILINE | | Synonyms: | 3-Bromo-4-(trifluoromethoxy)aniline 98%;3-Bromo-4-(trifluoromethoxy)aniline98%;1-Amino-3-bromo-4-(trifluoromethoxy)benzene;3-broMo-4-(trifluoroMethoxy)benzenaMine;4-AMINO-2-BROMO(TRIFLUOROMETHOXY)BENZENE;3-BROMO-4-(TRIFLUOROMETHOXY)ANILINE;Benzenamine, 3-bromo-4-(trifluoromethoxy)-;3-Bromo-4-(trifL | | CAS: | 191602-54-7 | | MF: | C7H5BrF3NO | | MW: | 256.02 | | EINECS: | 242-872-7 | | Product Categories: | Fluorine series | | Mol File: | 191602-54-7.mol |  |
| | 3-BROMO-4-(TRIFLUOROMETHOXY)ANILINE Chemical Properties |
| Boiling point | 236.6±35.0 °C(Predicted) | | density | 1.726±0.06 g/cm3(Predicted) | | refractive index | 1.5100-1.5140 | | Fp | 97 °C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | clear liquid | | pka | 2.67±0.10(Predicted) | | color | Colorless to Light yellow | | Specific Gravity | 1.72 | | InChI | InChI=1S/C7H5BrF3NO/c8-5-3-4(12)1-2-6(5)13-7(9,10)11/h1-3H,12H2 | | InChIKey | RAQMUBDHNKQNTD-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(OC(F)(F)F)C(Br)=C1 | | CAS DataBase Reference | 191602-54-7(CAS DataBase Reference) |
| | 3-BROMO-4-(TRIFLUOROMETHOXY)ANILINE Usage And Synthesis |
| Uses | 3-Bromo-4-(trifluoromethoxy)aniline is a pharmaceutical intermediate compound used in the preparation of Imatinib, a tyrosine kinase inhibitor (TKI) that inhibits the growth of cancers and is used as a drug for the treatment of chronic granulocytic leukaemia, gastrointestinal mesenchymal stromal tumours, and other malignancies. |
| | 3-BROMO-4-(TRIFLUOROMETHOXY)ANILINE Preparation Products And Raw materials |
|