|
|
| | 2-Isopropyl-2-adamantanol Basic information |
| Product Name: | 2-Isopropyl-2-adamantanol | | Synonyms: | 2-Isoproyl-2-AdaMantanol;2-IsopropyladaMantan-2-ol;2-isoipropyl-2-adaMantanol;2-Isopropyl-2-adamantanol(WS201366);2-ethtyl-2-adamantanol;2-isopropyl-2-hydroxyadamantane;2-Isopropyl-2-adamantanol 38432-77-8;2-(Propan-2-yl)tricyclo[3.3.1.13,7]decan-2-ol | | CAS: | 38432-77-8 | | MF: | C13H22O | | MW: | 194.31 | | EINECS: | | | Product Categories: | | | Mol File: | 38432-77-8.mol |  |
| | 2-Isopropyl-2-adamantanol Chemical Properties |
| Boiling point | 280℃ | | density | 1.039 | | Fp | 117℃ | | storage temp. | 2-8°C | | pka | 14.858±0.20(predicted) | | InChI | InChI=1S/C13H22O/c1-8(2)13(14)11-4-9-3-10(6-11)7-12(13)5-9/h8-12,14H,3-7H2,1-2H3 | | InChIKey | ZYAFZSLKABJJJQ-UHFFFAOYSA-N | | SMILES | C12CC3CC(CC(C3)C1(C(C)C)O)C2 |
| | 2-Isopropyl-2-adamantanol Usage And Synthesis |
| | 2-Isopropyl-2-adamantanol Preparation Products And Raw materials |
|