WITHASTRAMONOLIDE, 12-DEOXY-(SH) manufacturers
|
| | WITHASTRAMONOLIDE, 12-DEOXY-(SH) Basic information |
| Product Name: | WITHASTRAMONOLIDE, 12-DEOXY-(SH) | | Synonyms: | WITHASTRAMONOLIDE, 12-DEOXY-(SH);27-Hydroxywithanolide B;Baimantuoluoside C aglycone;(5α,6α,7α,22R)-6,7-Epoxy-5,22,27-trihydroxy-1-oxoergosta-2,24-dien-26-oic acid δ-lactone;Baimantuoluoside C;Ergosta-2,24-dien-26-oic acid, 6,7-epoxy-5,22,27-trihydroxy-1-oxo-, δ-lactone, (5α,6α,7α,22R)-;12-Deoxywithastramonolide-RM;12-Deoxywithastromonolide solution | | CAS: | 60124-17-6 | | MF: | C28H38O6 | | MW: | 470.6 | | EINECS: | | | Product Categories: | | | Mol File: | 60124-17-6.mol |  |
| | WITHASTRAMONOLIDE, 12-DEOXY-(SH) Chemical Properties |
| Boiling point | 668.3±55.0 °C(Predicted) | | density | 1.253 | | storage temp. | -20°C | | solubility | DMF: 2 mg/ml; DMSO: 0.1 mg/ml; Ethanol: 20 mg/ml; Ethanol:PBS (pH 7.2)(1:2): 0.3 mg/ml | | pka | 13.04±0.70(Predicted) | | form | Solid | | color | White to off-white | | InChIKey | AWVMHXZWAKRDGG-MEBIVHGNSA-N | | SMILES | O1[C@H](CC(=C(C1=O)CO)C)[C@H]([C@@H]2[C@@]3([C@H]([C@@H]4[C@@H]5O[C@@H]5[C@@]6([C@@]([C@H]4CC3)(C(=O)C=CC6)C)O)CC2)C)C |
| WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| | WITHASTRAMONOLIDE, 12-DEOXY-(SH) Usage And Synthesis |
| Uses | 12-Deoxywithastramonolide is a principle bioactive compound found in ashwagandha (W. somnifera). 12-Deoxywithastramonolide possesses antioxidant and enzyme inhibitory effects[1]. | | Definition | ChEBI: 12-deoxywithastramonolide is a withanolide. | | References | [1] Shivraj Hariram Nile, et al. Subcritical water extraction of withanosides and withanolides from ashwagandha (Withania somnifera L) and their biological activities. Food Chem Toxicol. 2019 Oct;132:110659. DOI:10.1016/j.fct.2019.110659 |
| | WITHASTRAMONOLIDE, 12-DEOXY-(SH) Preparation Products And Raw materials |
|