| Company Name: |
VDM Biochemicals
|
| Tel: |
0330-2528181 |
| Email: |
sales@vdmbio.com |
| Products Intro: |
Product Name:Chk2 Inhibitor
CAS:724708-21-8
Purity:>=95%
|
Chk2 Inhibitor manufacturers
- SC-203885
-
- $1390.00
-
2026-04-22
- CAS:724708-21-8
- Purity:
- Supply Ability: 10g
|
| | Chk2 Inhibitor Basic information |
| Product Name: | Chk2 Inhibitor | | Synonyms: | Chk2 Inhibitor;Chk2 Inhibitor - CAS 724708-21-8 - Calbiochem;Azepino[3,4-b]indol-1(2H)-one, 5-(2-amino-1,5-dihydro-5-oxo-4H-imidazol-4-ylidene)-3,4,5,10-tetrahydro-, (5Z)-;SC 203885;SC203885;SC-203885 | | CAS: | 724708-21-8 | | MF: | C15H13N5O2 | | MW: | 295.3 | | EINECS: | | | Product Categories: | Cholinergics | | Mol File: | 724708-21-8.mol |  |
| | Chk2 Inhibitor Chemical Properties |
| storage temp. | -20C | | solubility | DMSO: Soluble | | form | Pale yellow solid | | color | pale yellow | | InChIKey | FRROPNANZGODOW-MKFZHGHUSA-N | | SMILES | Cl.N1C(=N\C(=C2\CCNC(=O)c3[nH]c4c(c3\2)cccc4)\C1=O)N |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | Chk2 Inhibitor Usage And Synthesis |
| Uses | Chk2 Inhibitor is a checkpoint kinase inhibitor that mediates apoptosis and cell cycle arrest. | | General Description | A cell-permeable, ATP competitive, and reversible indoloazepine compound that displays anti-proliferative and anti-inflammatory properties. Acts as a potent inhibitor of Chk2 (IC50 = 8 nM) that targets the ATP binding pocket. Exhibits selectivity for Chk2 over MEK1, Chk1, CK1δ, PKCα, PKCβII and CK2 (IC50 = 89 nM, 237 nM, 1.352 μM, 2.539 μM, 3.381 μM, and >10.0 μM, respectively). Blocks the production of IL-2 and TNF-α by preventing the transcriptional activation of NF-κB (IC50 = 3.55 μM for IL-2 production in PMA-stimulated Jurkat T cells; 8.16 μM for TNF-α production in LPS-stimulated THP-1 cells). Also reported to suppress the growth of leukemic T cells (GI50 = 1.73 μM). | | Biochem/physiol Actions | Primary TargetChk2 | | IC 50 | Chk2: 13.5 nM (IC50); Chk1: 220.4 nM (IC50) |
| | Chk2 Inhibitor Preparation Products And Raw materials |
|