- 4-oxobutyl acetate
-
- $8.80
-
2019-07-06
- CAS: 6564-95-0
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 100kg
|
| | 4-oxobutyl acetate Basic information |
| | 4-oxobutyl acetate Chemical Properties |
| Boiling point | 59-60 °C(Press: 1 Torr) | | density | 1.0612 g/cm3 | | InChI | InChI=1S/C6H10O3/c1-6(8)9-5-3-2-4-7/h4H,2-3,5H2,1H3 | | InChIKey | OZTUJRSHRYXRFW-UHFFFAOYSA-N | | SMILES | C(=O)CCCOC(C)=O |
| | 4-oxobutyl acetate Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 70, p. 383, 1948 DOI: 10.1021/ja01181a119 |
| | 4-oxobutyl acetate Preparation Products And Raw materials |
|