- 1-NITRO-2-NAPHTHOL
-
-
2019-11-08
- CAS:550-60-7
- Min. Order: 1g
- Purity: 99.5%min
- Supply Ability: 20kg/week
|
| | 1-NITRO-2-NAPHTHOL Basic information |
| Product Name: | 1-NITRO-2-NAPHTHOL | | Synonyms: | 1-nitro-2-naphthalenol;1-nitro-2-naphtho;1-NITRO-2-NAPHTHOL;2-HYDROXY-1-NITRONAPHTHALENE;1-NITRO-2-NAPHTHOL 98+%;1-Nitro-2-hydroxynaphthalene;1-Nitro-beta-naphthol;1-Nitro-2-naphthol> | | CAS: | 550-60-7 | | MF: | C10H7NO3 | | MW: | 189.17 | | EINECS: | 208-984-5 | | Product Categories: | | | Mol File: | 550-60-7.mol |  |
| | 1-NITRO-2-NAPHTHOL Chemical Properties |
| Melting point | 103°C | | Boiling point | 324.41°C (rough estimate) | | density | 1.413 | | refractive index | 1.5400 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 6.30±0.50(Predicted) | | color | White to Yellow to Orange | | Water Solubility | 0.2g/L(20 ºC) | | Merck | 14,6614 | | InChI | InChI=1S/C10H7NO3/c12-9-6-5-7-3-1-2-4-8(7)10(9)11(13)14/h1-6,12H | | InChIKey | SSHIVHKMGVBXTJ-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=C2C(C=CC=C2)=CC=C1O |
| | 1-NITRO-2-NAPHTHOL Usage And Synthesis |
| Chemical Properties | Yellow crystals. Melting point 103-104. Soluble in ethanol, ether, and glacial acetic acid, insoluble in water. | | Purification Methods | Distil it under high vacuum and/or crystallise the naphthol (repeatedly) from *benzene/pet ether (b 60-80o)(1:1). [Beilstein 6 H 653, 6 III 3002, 6 IV 4370.] |
| | 1-NITRO-2-NAPHTHOL Preparation Products And Raw materials |
|