| Company Name: |
Sichuan BioCrick Biotech Co., Ltd Gold
|
| Tel: |
28-86-28-8543-3893 13260669172 |
| Email: |
sales@biocrick.com |
| Products Intro: |
Product Name:Saprirearine
CAS:453518-30-4
Purity:98% HPLC Package:5mg;10mg;20mg;50mg……1g
|
| Company Name: |
BioBioPha Co., Ltd.
|
| Tel: |
0871-65217109 13211707573; |
| Email: |
y.liu@mail.biobiopha.com |
| Products Intro: |
Product Name:Saprirearine
CAS:453518-30-4
Purity:>97.0% Package:5mg Remarks:BBP02814
|
|
| | (9aS)-7,8,9,9a-Tetrahydro-9a-hydroxy-6-methyl-9-(1-methylethenyl)-2-(1-methylethyl)-1H-phenalen-1-one Basic information |
| Product Name: | (9aS)-7,8,9,9a-Tetrahydro-9a-hydroxy-6-methyl-9-(1-methylethenyl)-2-(1-methylethyl)-1H-phenalen-1-one | | Synonyms: | (9aS)-7,8,9,9a-Tetrahydro-9a-hydroxy-6-methyl-9-(1-methylethenyl)-2-(1-methylethyl)-1H-phenalen-1-one;Saprirearine;1H-Phenalen-1-one, 7,8,9,9a-tetrahydro-9a-hydroxy-6-methyl-9-(1-methylethenyl)-2-(1-methylethyl)-, (9aS)- | | CAS: | 453518-30-4 | | MF: | C20H24O2 | | MW: | 296.4 | | EINECS: | | | Product Categories: | | | Mol File: | 453518-30-4.mol |  |
| | (9aS)-7,8,9,9a-Tetrahydro-9a-hydroxy-6-methyl-9-(1-methylethenyl)-2-(1-methylethyl)-1H-phenalen-1-one Chemical Properties |
| Boiling point | 419.0±45.0 °C(Predicted) | | density | 1.134±0.06 g/cm3(Predicted) | | pka | 11.83±0.60(Predicted) | | InChI | InChI=1S/C20H24O2/c1-11(2)16-10-14-7-6-13(5)15-8-9-17(12(3)4)20(22,18(14)15)19(16)21/h6-7,10-11,17,22H,3,8-9H2,1-2,4-5H3/t17,20-/m0/s1 | | InChIKey | DLCPEPBEODTUSV-OZBJMMHXSA-N | | SMILES | C1(=O)[C@@]2(O)C3C(CCC2C(C)=C)=C(C)C=CC=3C=C1C(C)C |
| | (9aS)-7,8,9,9a-Tetrahydro-9a-hydroxy-6-methyl-9-(1-methylethenyl)-2-(1-methylethyl)-1H-phenalen-1-one Usage And Synthesis |
| Uses | Saprirearine is a Diterpenoids product that can be isolated from the herbs of Salvia prionitis[1]. |
| | (9aS)-7,8,9,9a-Tetrahydro-9a-hydroxy-6-methyl-9-(1-methylethenyl)-2-(1-methylethyl)-1H-phenalen-1-one Preparation Products And Raw materials |
|