|
|
| | methyl (S)-2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride Basic information | | Application |
| Product Name: | methyl (S)-2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride | | Synonyms: | methyl (S)-2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride;(S)-Methyl 2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride;Lifitegrast Intermediate 5;methyl (2S)-2-amino-3-(3-methanesulfonylphenyl)propanoate hydrochloride;METHYL (S)-2-AMINO-3-(3-(METHYLSULFONYL)PHENYL)PROPANOATE HCL;methyl (2S)-2-amino-3-(3-methylsulfonylphenyl)propanoate;methyl(S)-2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hyd...;3-(Methylsulfonyl)-L-phenylalanine methyl ester hydrochloride | | CAS: | 851785-21-2 | | MF: | C11H16ClNO4S | | MW: | 293.76 | | EINECS: | | | Product Categories: | | | Mol File: | 851785-21-2.mol |  |
| | methyl (S)-2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1/C11H15NO4S.ClH/c1-16-11(13)10(12)7-8-4-3-5-9(6-8)17(2,14)15;/h3-6,10H,7,12H2,1-2H3;1H/t10-;/s3 | | InChIKey | VUUYKOLKOIYVCR-MEQOOBBNNA-N | | SMILES | C(C1C=CC=C(S(=O)(=O)C)C=1)[C@H](N)C(=O)OC.Cl |&1:11,r| |
| | methyl (S)-2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride Usage And Synthesis |
| Application | (S)-2-amino-3-methylsulfonyl-phenylpropionate methyl ester hydrochloride can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly in laboratory research and development processes and chemical and pharmaceutical synthesis processes. | | Synthesis | Hydrogenation of the compound (CAS: 851785-26-7) as starting material was carried out in methanol (MeOH) by hydrogen ballooning with palladium carbon (Pd/C) as catalyst to give compound 8.4 in 98% yield. The product was confirmed by electrospray ionization mass spectrometry (ESI-MS) with a mass-to-charge ratio (m/z) of 258 ([M+H]+). | | References | [1] Patent: WO2005/44817, 2005, A1. Location in patent: Page/Page column 92-93 |
| | methyl (S)-2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride Preparation Products And Raw materials |
|