- Dimethyl 3-nitrophthalate
-
- $100.47
-
2026-06-03
- CAS:13365-26-9
- Min. Order: 25Kg/Drum
- Purity: 98.00%HPLC
- Supply Ability: 3.5tons/month
|
| | DIMETHYL 3-NITROPHTHALATE Basic information |
| Product Name: | DIMETHYL 3-NITROPHTHALATE | | Synonyms: | 3-nitrobenzene-1,2-dicarboxylic acid dimethyl ester;dimethyl 3-nitrobenzene-1,2-dicarboxylate;NSC 68806;3-NITROPHTHALIC ACID DIMETHYL ESTER;3-NITRO-1,2-PHTHALIC ACID DIMETHYL ESTER;DIMETHYL 3-NITROPHTHALATE;1,2-BENZENEDICARBOXYLIC ACID, 3-NITRO-, 1,2-DIMETHYL ESTER;4,5-dimethyl-3-nitrophthalate | | CAS: | 13365-26-9 | | MF: | C10H9NO6 | | MW: | 239.18 | | EINECS: | | | Product Categories: | Aromatic Esters | | Mol File: | 13365-26-9.mol |  |
| | DIMETHYL 3-NITROPHTHALATE Chemical Properties |
| Melting point | 68-69°C | | Boiling point | 314.6±22.0 °C(Predicted) | | density | 1.350±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | powder to crystal | | color | White to Light yellow | | BRN | 1885570 | | InChI | InChI=1S/C10H9NO6/c1-16-9(12)6-4-3-5-7(11(14)15)8(6)10(13)17-2/h3-5H,1-2H3 | | InChIKey | MLQMIKSBTAZNBK-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=CC=CC([N+]([O-])=O)=C1C(OC)=O | | CAS DataBase Reference | 13365-26-9(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | HS Code | 2917.39.7000 |
| Provider | Language |
|
ALFA
| English |
| | DIMETHYL 3-NITROPHTHALATE Usage And Synthesis |
| | DIMETHYL 3-NITROPHTHALATE Preparation Products And Raw materials |
|