|
|
| | Diethyl nitromalonate Basic information |
| | Diethyl nitromalonate Chemical Properties |
| Boiling point | 78-80 °C/0.2 mmHg (lit.) | | density | 1.174 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.428(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | pka | 6.46±0.59(Predicted) | | form | liquid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C7H11NO6/c1-3-13-6(9)5(8(11)12)7(10)14-4-2/h5H,3-4H2,1-2H3 | | InChIKey | DAKKWKYIQGMKOS-UHFFFAOYSA-N | | SMILES | CCOC(=O)C(C(=O)OCC)[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Diethyl nitromalonate Usage And Synthesis |
| Chemical Properties | Colorless liquid, boiling point 78-80℃ (26.7Pa). | | Uses | Diethyl nitromalonate has been used in the preparation of 5,5-diethoxycarbonyl-1-pyrroline N-oxide (DECPO). | | Synthesis Reference(s) | Journal of the American Chemical Society, 77, p. 4391, 1955 DOI: 10.1021/ja01621a060 | | General Description | Thermal decomposition of diethyl nitromalonate to furoxan has been studied. |
| | Diethyl nitromalonate Preparation Products And Raw materials |
|