|
|
| | Sinalbin potassium salt Basic information |
| Product Name: | Sinalbin potassium salt | | Synonyms: | Sinalbin potassium salt;Sinalbin Kaliumsalz;Glucosinalbate potassium;potassiump-hydroxybenzylglucosinolate;Sinalbin potassium;Sinalbin Potassium Salt Reference Standard Grade, 98%;Sinalbin potassium salt-RM;Glucosinalbate potassium (Standard) | | CAS: | 16411-05-5 | | MF: | C14H20KNO10S2 | | MW: | 465.53 | | EINECS: | | | Product Categories: | | | Mol File: | 16411-05-5.mol |  |
| | Sinalbin potassium salt Chemical Properties |
| storage temp. | 2-8°C | | Major Application | food and beverages | | SMILES | O[C@@H]1[C@@H](O)[C@H](S/C(CC2=CC=C(O)C=C2)=N/OS(=O)(O[K])=O)O[C@H](CO)[C@H]1O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | Sinalbin potassium salt Usage And Synthesis |
| Uses | Sinalbin Potassium is a salt analog of Sinalbin , which is found in mustard seeds and hydrolyzed by the enzyme myrosinase present in the seeds resulting in p-hydroxybenzyl isothiocyanate (IHB). |
| | Sinalbin potassium salt Preparation Products And Raw materials |
|