|
|
| | Acetyl tetrapeptide 15 Basic information |
| Product Name: | Acetyl tetrapeptide 15 | | Synonyms: | Acetyl tetrapeptide 15;N-Acetyl-L-tyrosyl-L-prolyl-L-phenylalanyl-L-phenylalaninamide;Skinasensyl;acetyl tetrapeptide-15/Skinasensyl LS 9749;(2S)-1-[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]-N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide;L-Phenylalaninamide, N-acetyl-L-tyrosyl-L-prolyl-L-phenylalanyl-;AC-PPLY-OH;Acetyl tetrapeptide 15 USP/EP/BP | | CAS: | 928007-64-1 | | MF: | C34H39N5O6 | | MW: | 613.7 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 928007-64-1.mol |  |
| | Acetyl tetrapeptide 15 Chemical Properties |
| Boiling point | 1055.2±65.0 °C(Predicted) | | density | 1.285±0.06 g/cm3(Predicted) | | storage temp. | -20°C, protect from light | | form | Solid | | pka | 9.84±0.15(Predicted) | | color | White to off-white | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChIKey | BSXFOBDOGHFWOC-KRCBVYEFSA-N | | SMILES | C(N)(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC1=CC=C(O)C=C1)NC(C)=O |
| | Acetyl tetrapeptide 15 Usage And Synthesis |
| Uses | Acetyl tetrapeptide-15 is a synthetic peptide used in cosmetics for sensitive skin. It is derived from endorphin-2 (Tyr-Pro-Phe-Phe-NH2), a human μ-opioid receptor agonist with selective antinociceptive effects. Acetyltetrapeptide-15 raises the excitatory threshold of μ-opioid receptor neurons via an endorphin-like pathway, thereby decreasing skin hyperreactivity and reducing inflammatory, chronic and neuropathic pain. | | benefits | Acetyl Tetrapeptide-15 is super anti-allergic peptide, potent anti-
inflammation, decrease nerve sensitivity,improveskin tolerance threshold, anti-itching, anti-aching,prevent and relieve irritant symptoms, e.g-
redness, hormone replacementto be used in
anti-allergy , anti-sensitive and anti-inflammation.Its recommended dosage is 0.2~6%. | | General Description | Acetyl Tetrapeptide-15 is the reaction product of acetic acid and Tetrapeptide-15. It is a polypeptide that can improve the natural tolerance threshold of the skin, by improving the skin's tolerance to environmental factors, alleviating the discomfort caused by cosmetics and skin treatments, and achieving the purpose of alleviating skin sensitivity, this peptide is similar to a natural opioid peptide that can reduce the stimulation of skin nerve endings |
| | Acetyl tetrapeptide 15 Preparation Products And Raw materials |
|