|
|
| | 3,3-Diphenyl-3H-naphtho[2,1-b]pyran Basic information |
| Product Name: | 3,3-Diphenyl-3H-naphtho[2,1-b]pyran | | Synonyms: | 3,3-Diphenyl-3H-benzo[f]chromene;3,3-DIPHENYL-3H-NAPHTHO[2,1-B]PYRAN;2,2-Diphenyl-2H-1-oxaphenanthrene;2,2-Diphenyl-5,6-[1,3]butadieno-2H-1-benzopyran;2,2-Diphenyl-5,6-benzo(2H)chromene;3,3-diphenyl-3H-benz;3,3-DIPHENYL-3H-NAPHTHO[2,1-B]BYRAN;3,3-diphenyl-3H-naphtho[2,1-b]byran | | CAS: | 4222-20-2 | | MF: | C25H18O | | MW: | 334.41 | | EINECS: | | | Product Categories: | Azobenzene, etc. (Photochromic Compounds);Functional Materials;Photochromic Compounds | | Mol File: | 4222-20-2.mol | ![3,3-Diphenyl-3H-naphtho[2,1-b]pyran Structure](CAS/GIF/4222-20-2.gif) |
| | 3,3-Diphenyl-3H-naphtho[2,1-b]pyran Chemical Properties |
| Melting point | 160°C | | Boiling point | 511.1±50.0 °C(Predicted) | | density | 1.187±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow | | Cosmetics Ingredients Functions | ANTIOXIDANT
COLORANT | | InChI | InChI=1S/C25H18O/c1-3-10-20(11-4-1)25(21-12-5-2-6-13-21)18-17-23-22-14-8-7-9-19(22)15-16-24(23)26-25/h1-18H | | InChIKey | UBNNJVRNPJVYBU-UHFFFAOYSA-N | | SMILES | C12=CC=C3C(=C1C=CC(C1=CC=CC=C1)(C1=CC=CC=C1)O2)C=CC=C3 | | EPA Substance Registry System | 3H-Naphtho[2,1-b]pyran, 3,3-diphenyl- (4222-20-2) |
| | 3,3-Diphenyl-3H-naphtho[2,1-b]pyran Usage And Synthesis |
| Uses | 3,3-Diphenyl-3H-naphtho[2,1-b]pyran is a useful research chemical compound used in the preparation and photochromism of naphthopyrans, pyranoquinolines, pyranoquinazolines, and pyranoquinoxalines. | | Synthesis | The building of the 3,3-diphenyl-3H-naphtho[2,1-b]pyrans can be achieved by a 'one-pot reaction' starting from a suitable naphthol and 1,1-diphenyl-2-yn-1-ol[1]. This condensation reaction takes place in an apolar solvent (toluene, CH2Cl2) under acid catalysis.
![synthesis of 3,3-Diphenyl-3H-naphtho[2,1-b]pyran](/NewsImg/2026-05-07/6391374762164524085224663.png "synthesis of 3,3-Diphenyl-3H-naphtho[2,1-b]pyran") | | References | [1] Frigoli, M., Moustrou, C., Samat, A., & Guglielmetti, R. (2003). Synthesis of New Thiophene-Substituted 3,3-Diphenyl-3H-naphtho[2,1-b]pyrans by Cross-Coupling Reactions, Precursors of Photomodulated Materials. European Journal of Organic Chemistry, 2003 15, 2799–2812. https://doi.org/10.1002/ejoc.200300033
|
| | 3,3-Diphenyl-3H-naphtho[2,1-b]pyran Preparation Products And Raw materials |
|