|
|
| | 4-Chloro-2-methyl-6-nitroaniline Basic information |
| | 4-Chloro-2-methyl-6-nitroaniline Chemical Properties |
| Melting point | 126-132 °C | | Boiling point | 328.7±37.0 °C(Predicted) | | density | 1.4800 (rough estimate) | | refractive index | 1.5560 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | Crystals or Needles | | pka | -1.18±0.25(Predicted) | | color | Orange | | InChI | InChI=1S/C7H7ClN2O2/c1-4-2-5(8)3-6(7(4)9)10(11)12/h2-3H,9H2,1H3 | | InChIKey | QDSCDFKGUAONPC-UHFFFAOYSA-N | | SMILES | C1(N)=C([N+]([O-])=O)C=C(Cl)C=C1C | | CAS DataBase Reference | 62790-50-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | RIDADR | 2811 | | HazardClass | IRRITANT | | HS Code | 29214200 |
| | 4-Chloro-2-methyl-6-nitroaniline Usage And Synthesis |
| Chemical Properties | orange crystals or needles | | Uses |
4-Chloro-2-methyl-6-nitroaniline is used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
|
| | 4-Chloro-2-methyl-6-nitroaniline Preparation Products And Raw materials |
|