|
|
| Product Name: | PCzAc | | Synonyms: | PCzAc;9,10-Dihydro-9,9-dimethyl-10- (9-phenyl-9H-carbazol-3-yl)-acridine;9,9-Dimethyl-10-(9-phenyl-9H-carbazol-2-yl)-9,10-dihydro-acridine;Acridine, 9,10-dihydro-9,9-dimethyl-10-(9-phenyl-9H-carbazol-3-yl)-;9,9-Dimethyl-10-(9-phenyl-9H-carbazol-3-yl)-9,10-dihydroacridine;9,10-Dihydro-9,9-dimethyl-10- (9-phenyl-9H-carbazol-3-yl)-acridine | | CAS: | 1705584-08-2 | | MF: | C33H26N2 | | MW: | 450.57 | | EINECS: | | | Product Categories: | | | Mol File: | 1705584-08-2.mol |  |
| | PCzAc Chemical Properties |
| Boiling point | 617.7±53.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | solubility | chloroform: soluble
dibromomethane: soluble
toluene: soluble | | pka | 0.54±0.40(Predicted) | | InChI | InChI=1S/C33H26N2/c1-33(2)27-15-7-10-18-31(27)35(32-19-11-8-16-28(32)33)24-20-21-30-26(22-24)25-14-6-9-17-29(25)34(30)23-12-4-3-5-13-23/h3-22H,1-2H3 | | InChIKey | UMKRTVOLHYYZHW-UHFFFAOYSA-N | | SMILES | C1=C2C(N(C3=CC4C5=C(N(C6=CC=CC=C6)C=4C=C3)C=CC=C5)C3=C(C2(C)C)C=CC=C3)=CC=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | PCzAc Usage And Synthesis |
| Description |
PCzAc: a hole transport type high triplet energy material
9,10-Dihydro-9,9-dimethyl-10-(9-phenyl-9H-carbazol-3-yl)-acridine is a dihydroacridine derivative known as PCzAc. It was newly designed as a hole transport type high triplet energy material for application as a hole transport type exciton blocking layer of blue phosphorescent organic light-emitting diodes. PCzAc exhibits a shallow HOMO level due to the acridine unit. The PCZAC compound provided a high triplet energy of 2.99 eV and a high glass transition temperature of 101 °C for high efficiency and long lifetime. PCZAC showed an improved quantum efficiency and more than 8 times improvement in the lifetime of blue phosphorescent organic light-emitting diodes[1].
| | References | [1] Seo, Jeong-A et al. “Long lifetime blue phosphorescent organic light-emitting diodes with an exciton blocking layer.” Journal of Materials Chemistry C 18 (2015): 4640–4645.
|
| | PCzAc Preparation Products And Raw materials |
|